Introduction：Basic information about CLODRONIC ACID CAS 10596-23-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
CLODRONIC ACID Basic information
| Product Name: | CLODRONIC ACID |
| Synonyms: | CLODRONIC ACID;Disodium diphosphonate;Clodronic;(Dichloromethylene)bis(phosphonic acid);ARC-69931;Dichloromethylenebis(phosphonic acid);Dichloromethylenebisphosphonic acid;Aids071014 |
| CAS: | 10596-23-3 |
| MF: | CH4Cl2O6P2 |
| MW: | 244.89 |
| EINECS: | 234-212-1 |
| Product Categories: | |
| Mol File: | 10596-23-3.mol |
|
CLODRONIC ACID Chemical Properties
| Melting point | 249-251° |
| Boiling point | 474.7±55.0 °C(Predicted) |
| density | 2.306±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | Solid |
| pka | 0.75±0.10(Predicted) |
| color | Off-white to light yellow |
| InChI | InChI=1S/CH4Cl2O6P2/c2-1(3,10(4,5)6)11(7,8)9/h(H2,4,5,6)(H2,7,8,9) |
| InChIKey | ACSIXWWBWUQEHA-UHFFFAOYSA-N |
| SMILES | C(P(=O)(O)O)(P(=O)(O)O)(Cl)Cl |
Safety Information
CLODRONIC ACID Usage And Synthesis
| Uses | Regulator (calcium). |
| Uses | Clodronic Acid is a bisphosphonate that can be used in the treatment of osteoporosis. Its ATP-analogs can inhibit cell signaling pathways. |
| Definition | ChEBI: An organochlorine compound that is methylene chloride in which both hydrogens are replaced by phosphonic acid groups. It inhibits bone resorption and soft tissue calcification, and is used (often as the disodium salt tetrahydrate) as an adjunct in the treament of severe hypercalcaemia associated with malignancy, and in the management of osteolytic lesions and bone pain associated with skeletal metastases. |
CLODRONIC ACID Preparation Products And Raw materials
| Raw materials | Dibromomethane |
