Fenpropimorph CAS 67564-91-4
Introduction：Basic information about Fenpropimorph CAS 67564-91-4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Fenpropimorph Basic informationDescription References
| Product Name: | Fenpropimorph |
| Synonyms: | Einecs 266-719-9;Fenpropimorph cis-form;(2R,6S)-rel-4-[3-[4-(1,1-DiMethylethyl)phenyl]-2-Methylpropyl]-2,6-diMethylMorpholine;cis-4-[3-[4-(1,1-DiMethylethyl)phenyl]-2-Methylpropyl]-2,6-diMethylMorpholine;Amorolfine EP Impurity D;FENPROPIMORPH PESTANAL 250 MG;(2β,6β)-4-[3-[4-(1,1-Dimethylethyl)phenyl]-2-methylpropyl]-2,6-dimethylmorpholine;fenpropimorf |
| CAS: | 67564-91-4 |
| MF: | C20H33NO |
| MW: | 303.48 |
| EINECS: | 266-719-9 |
| Product Categories: | Agro-Products;Aromatics;Chiral Reagents;Heterocycles;Alpha sort;E-GAlphabetic;F;FA - FLPesticides;Fungicides;Morpholines;Pesticides&Metabolites |
| Mol File: | 67564-91-4.mol |
Fenpropimorph Chemical Properties
| Melting point | 25°C |
| Boiling point | 444.4°C (rough estimate) |
| density | 0.9804 (rough estimate) |
| vapor pressure | 0.004Pa at 20℃ |
| refractive index | 1.5614 (estimate) |
| Fp | >100 °C |
| storage temp. | Store at -20°C |
| solubility | DMF: 15 mg/ml,DMSO: 5 mg/ml,Ethanol: 15 mg/ml,Ethanol:PBS (pH 7.2)(1:2): 0.3 mg/ml |
| form | A neat oil |
| pka | 7.34±0.10(Predicted) |
| Appearance | Colorless to light yellow Liquid |
| Water Solubility | 4.32mg/L at 20℃ |
| Merck | 13,4021 |
| Major Application | agriculture cleaning products cosmetics environmental food and beverages personal care |
| InChI | 1S/C20H33NO/c1-15(12-21-13-16(2)22-17(3)14-21)11-18-7-9-19(10-8-18)20(4,5)6/h7-10,15-17H,11-14H2,1-6H3 |
| InChIKey | RYAUSSKQMZRMAI-UHFFFAOYSA-N |
| SMILES | CC(CN1CC(C)OC(C)C1)Cc2ccc(cc2)C(C)(C)C |
| LogP | 4.930 |
| EPA Substance Registry System | Fenpropimorph (67564-91-4) |
Safety Information
| Hazard Codes | Xn;N,N,Xn |
| Risk Statements | 22-38-51/53-63 |
| Safety Statements | 36/37-46-61 |
| RIDADR | UN 3082 |
| WGK Germany | WGK 3 |
| RTECS | QE1940000 |
| HS Code | 29349990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 2 Repr. 2 Skin Irrit. 2 |
| Description | Fenpropimorph is a morpholine fungicide. It is colorless, odorless oil. Fenpropimorph, a systemic fungicide, absorbed through the leaves and roots, has protective and curative properties. It can inhibit the sterol pathway. It is mostly used for the control of fungal diseases, including powdery mildew, scald, yellow & brown rusts, and Mycosphaerella. Its is major use is to control diseases in cereals including wheat, barley, oats, rye, and triticale. It could be also applied on bananas, plantains, sugarbeet and beans. |
| References | [1] http://sitem.herts.ac.uk/aeru/ppdb/en/Reports/308.htm [2] Kalyani Paranjape, Vasant Gowariker, V N Krishnamurthy, Sugha Gowariker (2013) The Pesticide Encyclopedia |
| Uses | Systemic fungicide for control of powdery mildew, rust in cereal crops. |
| Uses | Systemic fungicide. |
| Definition | ChEBI: (2S,6R)-4-[3-(4-tert-butylphenyl)-2-methylpropyl]-2,6-dimethylmorpholine is an alkylbenzene. |
| Flammability and Explosibility | Not classified |
Fenpropimorph Preparation Products And Raw materials
| Raw materials | Lily aldehyde-->Dimethylmorpholine |
| Preparation Products | Amorolfine |
